C22H22Cl4N6O6 — CID 161189030
(3,5-dichloro-2-pyridinyl)hydrazine;methyl 2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazole-3-carboxylate;methyl 2,4-dioxopentanoate (PubChem CID 161189030) has the molecular formula C22H22Cl4N6O6 and a molecular weight of 608.27 g/mol. Its IUPAC name is (3,5-dichloro-2-pyridinyl)hydrazine;methyl 2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazole-3-carboxylate;methyl 2,4-dioxopentanoate.
| Compound Name | (3,5-dichloro-2-pyridinyl)hydrazine;methyl 2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazole-3-carboxylate;methyl 2,4-dioxopentanoate |
|---|---|
| PubChem CID | 161189030 |
| Molecular Formula | C22H22Cl4N6O6 |
| Molecular Weight | 608.27 g/mol |
| Exact Mass | 606.04 |
| IUPAC Name | (3,5-dichloro-2-pyridinyl)hydrazine;methyl 2-(3,5-dichloro-2-pyridinyl)-5-methylpyrazole-3-carboxylate;methyl 2,4-dioxopentanoate |
| SMILES | COC(=O)C(=O)CC(C)=O.COC(=O)c1cc(C)nn1-c1ncc(Cl)cc1Cl.NNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2N3O2.C6H8O4.C5H5Cl2N3/c1-6-3-9(11(17)18-2)16(15-6)10-8(13)4-7(12)5-14-10;1-4(7)3-5(8)6(9)10-2;6-3-1-4(7)5(10-8)9-2-3/h3-5H,1-2H3;3H2,1-2H3;1-2H,8H2,(H,9,10) |
| InChIKey | UTLVAARQNQNZTC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 168.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|