C6H10N12S3 — CID 161195709
1-methyl-5-[(1-methyltetrazol-5-yl)disulfanyl]tetrazole;1-methyl-2H-tetrazole-5-thione (PubChem CID 161195709) has the molecular formula C6H10N12S3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-methyl-5-[(1-methyltetrazol-5-yl)disulfanyl]tetrazole;1-methyl-2H-tetrazole-5-thione.
| Compound Name | 1-methyl-5-[(1-methyltetrazol-5-yl)disulfanyl]tetrazole;1-methyl-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 161195709 |
| Molecular Formula | C6H10N12S3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1-methyl-5-[(1-methyltetrazol-5-yl)disulfanyl]tetrazole;1-methyl-2H-tetrazole-5-thione |
| SMILES | Cn1[nH]nnc1=S.Cn1nnnc1SSc1nnnn1C |
| InChI | InChI=1S/C4H6N8S2.C2H4N4S/c1-11-3(5-7-9-11)13-14-4-6-8-10-12(4)2;1-6-2(7)3-4-5-6/h1-2H3;1H3,(H,3,5,7) |
| InChIKey | UUHSAVCPBBMVEQ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 133.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|