C39H40F2N2O7 — CID 161199123
tert-butyl 3,6-dihydro-2H-pyran-3-yl carbonate;3-fluoro-9H-carbazole;(3S,4R,5S)-5-(3-fluorocarbazol-9-yl)oxane-3,4-diol (PubChem CID 161199123) has the molecular formula C39H40F2N2O7 and a molecular weight of 686.75 g/mol. Its IUPAC name is tert-butyl 3,6-dihydro-2H-pyran-3-yl carbonate;3-fluoro-9H-carbazole;(3S,4R,5S)-5-(3-fluorocarbazol-9-yl)oxane-3,4-diol.
| Compound Name | tert-butyl 3,6-dihydro-2H-pyran-3-yl carbonate;3-fluoro-9H-carbazole;(3S,4R,5S)-5-(3-fluorocarbazol-9-yl)oxane-3,4-diol |
|---|---|
| PubChem CID | 161199123 |
| Molecular Formula | C39H40F2N2O7 |
| Molecular Weight | 686.75 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | tert-butyl 3,6-dihydro-2H-pyran-3-yl carbonate;3-fluoro-9H-carbazole;(3S,4R,5S)-5-(3-fluorocarbazol-9-yl)oxane-3,4-diol |
| SMILES | CC(C)(C)OC(=O)OC1C=CCOC1.Fc1ccc2[nH]c3ccccc3c2c1.O[C@H]1[C@@H](O)COC[C@@H]1n1c2ccccc2c2cc(F)ccc21 |
| InChI | InChI=1S/C17H16FNO3.C12H8FN.C10H16O4/c18-10-5-6-14-12(7-10)11-3-1-2-4-13(11)19(14)15-8-22-9-16(20)17(15)21;13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12;1-10(2,3)14-9(11)13-8-5-4-6-12-7-8/h1-7,15-17,20-21H,8-9H2;1-7,14H;4-5,8H,6-7H2,1-3H3/t15-,16-,17+;;/m0../s1 |
| InChIKey | UUSYQDRQWSGGBK-PXXDYJNNSA-N |
| XLogP | 7.58 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.75 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|