C30H29F2N7O2 — CID 161201495
1-[(2R)-2-[[4-amino-3-[2-fluoro-4-(3-fluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one (PubChem CID 161201495) has the molecular formula C30H29F2N7O2 and a molecular weight of 557.61 g/mol. Its IUPAC name is 1-[(2R)-2-[[4-amino-3-[2-fluoro-4-(3-fluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one.
| Compound Name | 1-[(2R)-2-[[4-amino-3-[2-fluoro-4-(3-fluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one |
|---|---|
| PubChem CID | 161201495 |
| Molecular Formula | C30H29F2N7O2 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 1-[(2R)-2-[[4-amino-3-[2-fluoro-4-(3-fluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one |
| SMILES | [C-]#[N+]C(=CC(C)(C)C)C(=O)N1CCC[C@@H]1Cn1nc(-c2ccc(Oc3cccc(F)c3)cc2F)c2c(N)ncnc21 |
| InChI | InChI=1S/C30H29F2N7O2/c1-30(2,3)15-24(34-4)29(40)38-12-6-8-19(38)16-39-28-25(27(33)35-17-36-28)26(37-39)22-11-10-21(14-23(22)32)41-20-9-5-7-18(31)13-20/h5,7,9-11,13-15,17,19H,6,8,12,16H2,1-3H3,(H2,33,35,36)/t19-/m1/s1 |
| InChIKey | UVAORICXGRQHCG-LJQANCHMSA-N |
| XLogP | 5.99 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|