C33H42Br2Sn — CID 161202030
1,3-dibromoazulene;tributyl-(3-methylazulen-1-yl)stannane (PubChem CID 161202030) has the molecular formula C33H42Br2Sn and a molecular weight of 717.22 g/mol. Its IUPAC name is 1,3-dibromoazulene;tributyl-(3-methylazulen-1-yl)stannane.
| Compound Name | 1,3-dibromoazulene;tributyl-(3-methylazulen-1-yl)stannane |
|---|---|
| PubChem CID | 161202030 |
| Molecular Formula | C33H42Br2Sn |
| Molecular Weight | 717.22 g/mol |
| Exact Mass | 716.07 |
| IUPAC Name | 1,3-dibromoazulene;tributyl-(3-methylazulen-1-yl)stannane |
| SMILES | Brc1cc(Br)c2cccccc1-2.CCCC[Sn](CCCC)(CCCC)c1cc(C)c2cccccc1-2 |
| InChI | InChI=1S/C11H9.C10H6Br2.3C4H9.Sn/c1-9-7-8-10-5-3-2-4-6-11(9)10;11-9-6-10(12)8-5-3-1-2-4-7(8)9;3*1-3-4-2;/h2-7H,1H3;1-6H;3*1,3-4H2,2H3; |
| InChIKey | UVCJWRXWZGARJN-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.22 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |