C21H21BrFNO3 — CID 161208780
2-benzyl-5-(4-bromo-2-fluorophenyl)-4-oxo-N-(2-oxopropyl)pentanamide (PubChem CID 161208780) has the molecular formula C21H21BrFNO3 and a molecular weight of 434.31 g/mol. Its IUPAC name is 2-benzyl-5-(4-bromo-2-fluorophenyl)-4-oxo-N-(2-oxopropyl)pentanamide.
| Compound Name | 2-benzyl-5-(4-bromo-2-fluorophenyl)-4-oxo-N-(2-oxopropyl)pentanamide |
|---|---|
| PubChem CID | 161208780 |
| Molecular Formula | C21H21BrFNO3 |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-benzyl-5-(4-bromo-2-fluorophenyl)-4-oxo-N-(2-oxopropyl)pentanamide |
| SMILES | CC(=O)CNC(=O)C(CC(=O)Cc1ccc(Br)cc1F)Cc1ccccc1 |
| InChI | InChI=1S/C21H21BrFNO3/c1-14(25)13-24-21(27)17(9-15-5-3-2-4-6-15)11-19(26)10-16-7-8-18(22)12-20(16)23/h2-8,12,17H,9-11,13H2,1H3,(H,24,27) |
| InChIKey | UVYOKWBNUYGBHZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |