C18H19BrFNOS — CID 41138766
(2R)-2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-N-(2-phenylethyl)propanamide (PubChem CID 41138766) has the molecular formula C18H19BrFNOS and a molecular weight of 396.33 g/mol. Its IUPAC name is (2R)-2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-N-(2-phenylethyl)propanamide.
| Compound Name | (2R)-2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 41138766 |
| Molecular Formula | C18H19BrFNOS |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | (2R)-2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-N-(2-phenylethyl)propanamide |
| SMILES | C[C@@H](SCc1ccc(Br)cc1F)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H19BrFNOS/c1-13(23-12-15-7-8-16(19)11-17(15)20)18(22)21-10-9-14-5-3-2-4-6-14/h2-8,11,13H,9-10,12H2,1H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | KCNNUPHDUNDHMK-CYBMUJFWSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |