C26H32N2O — CID 161209218
2-(3-tert-butylphenyl)-1-pyridin-3-ylethanone;4-tert-butylpyridine (PubChem CID 161209218) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is 2-(3-tert-butylphenyl)-1-pyridin-3-ylethanone;4-tert-butylpyridine.
| Compound Name | 2-(3-tert-butylphenyl)-1-pyridin-3-ylethanone;4-tert-butylpyridine |
|---|---|
| PubChem CID | 161209218 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 2-(3-tert-butylphenyl)-1-pyridin-3-ylethanone;4-tert-butylpyridine |
| SMILES | CC(C)(C)c1cccc(CC(=O)c2cccnc2)c1.CC(C)(C)c1ccncc1 |
| InChI | InChI=1S/C17H19NO.C9H13N/c1-17(2,3)15-8-4-6-13(10-15)11-16(19)14-7-5-9-18-12-14;1-9(2,3)8-4-6-10-7-5-8/h4-10,12H,11H2,1-3H3;4-7H,1-3H3 |
| InChIKey | UVZWVWPLGNEUSN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |