C19H27ClN4 — CID 161211236
N-[(3R)-1-[[(2R)-pyrrolidin-2-yl]methyl]piperidin-3-yl]isoquinolin-6-amine;hydrochloride (PubChem CID 161211236) has the molecular formula C19H27ClN4 and a molecular weight of 346.91 g/mol. Its IUPAC name is N-[(3R)-1-[[(2R)-pyrrolidin-2-yl]methyl]piperidin-3-yl]isoquinolin-6-amine;hydrochloride.
| Compound Name | N-[(3R)-1-[[(2R)-pyrrolidin-2-yl]methyl]piperidin-3-yl]isoquinolin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 161211236 |
| Molecular Formula | C19H27ClN4 |
| Molecular Weight | 346.91 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[(3R)-1-[[(2R)-pyrrolidin-2-yl]methyl]piperidin-3-yl]isoquinolin-6-amine;hydrochloride |
| SMILES | Cl.c1cc2cc(N[C@@H]3CCCN(C[C@H]4CCCN4)C3)ccc2cn1 |
| InChI | InChI=1S/C19H26N4.ClH/c1-3-18(21-8-1)13-23-10-2-4-19(14-23)22-17-6-5-16-12-20-9-7-15(16)11-17;/h5-7,9,11-12,18-19,21-22H,1-4,8,10,13-14H2;1H/t18-,19-;/m1./s1 |
| InChIKey | DVGZEDBBNRGVGU-STYNFMPRSA-N |
| XLogP | 3.28 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.91 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |