C22H23ClF3N3 — CID 24967850
N-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]isoquinolin-6-amine;hydrochloride (PubChem CID 24967850) has the molecular formula C22H23ClF3N3 and a molecular weight of 421.89 g/mol. Its IUPAC name is N-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]isoquinolin-6-amine;hydrochloride.
| Compound Name | N-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]isoquinolin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 24967850 |
| Molecular Formula | C22H23ClF3N3 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]isoquinolin-6-amine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc(CN2CCC(Nc3ccc4cnccc4c3)CC2)cc1 |
| InChI | InChI=1S/C22H22F3N3.ClH/c23-22(24,25)19-4-1-16(2-5-19)15-28-11-8-20(9-12-28)27-21-6-3-18-14-26-10-7-17(18)13-21;/h1-7,10,13-14,20,27H,8-9,11-12,15H2;1H |
| InChIKey | ITKAHOREEZYEJM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |