C17H19F3N4 — CID 133471203
6-methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]pyrazin-2-amine (PubChem CID 133471203) has the molecular formula C17H19F3N4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 6-methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]pyrazin-2-amine.
| Compound Name | 6-methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 133471203 |
| Molecular Formula | C17H19F3N4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 6-methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]pyrazin-2-amine |
| SMILES | Cc1cncc(NC2CCN(Cc3ccc(C(F)(F)F)cc3)C2)n1 |
| InChI | InChI=1S/C17H19F3N4/c1-12-8-21-9-16(22-12)23-15-6-7-24(11-15)10-13-2-4-14(5-3-13)17(18,19)20/h2-5,8-9,15H,6-7,10-11H2,1H3,(H,22,23) |
| InChIKey | KKNBXCZBXDZWCE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |