C24H31Cl2N5O2S — CID 161485084
N'-[2-chloro-5-[[(3R)-3-(isoquinolin-6-ylamino)pyrrolidin-1-yl]methyl]phenyl]sulfonyl-N,N-dimethylmethanimidamide;methane;hydrochloride (PubChem CID 161485084) has the molecular formula C24H31Cl2N5O2S and a molecular weight of 524.52 g/mol. Its IUPAC name is N'-[2-chloro-5-[[(3R)-3-(isoquinolin-6-ylamino)pyrrolidin-1-yl]methyl]phenyl]sulfonyl-N,N-dimethylmethanimidamide;methane;hydrochloride.
| Compound Name | N'-[2-chloro-5-[[(3R)-3-(isoquinolin-6-ylamino)pyrrolidin-1-yl]methyl]phenyl]sulfonyl-N,N-dimethylmethanimidamide;methane;hydrochloride |
|---|---|
| PubChem CID | 161485084 |
| Molecular Formula | C24H31Cl2N5O2S |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N'-[2-chloro-5-[[(3R)-3-(isoquinolin-6-ylamino)pyrrolidin-1-yl]methyl]phenyl]sulfonyl-N,N-dimethylmethanimidamide;methane;hydrochloride |
| SMILES | C.CN(C)C=NS(=O)(=O)c1cc(CN2CC[C@@H](Nc3ccc4cnccc4c3)C2)ccc1Cl.Cl |
| InChI | InChI=1S/C23H26ClN5O2S.CH4.ClH/c1-28(2)16-26-32(30,31)23-11-17(3-6-22(23)24)14-29-10-8-21(15-29)27-20-5-4-19-13-25-9-7-18(19)12-20;;/h3-7,9,11-13,16,21,27H,8,10,14-15H2,1-2H3;1H4;1H/t21-;;/m1../s1 |
| InChIKey | OPULRPOLKVOJSU-GHVWMZMZSA-N |
| XLogP | 4.91 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|