C34H39ClN2O4 — CID 161215544
(1R,2S)-1,2-diphenylpropan-1-amine;methyl carbonochloridate;methyl N-[(1R,2S)-1,2-diphenylpropyl]carbamate (PubChem CID 161215544) has the molecular formula C34H39ClN2O4 and a molecular weight of 575.15 g/mol. Its IUPAC name is (1R,2S)-1,2-diphenylpropan-1-amine;methyl carbonochloridate;methyl N-[(1R,2S)-1,2-diphenylpropyl]carbamate.
| Compound Name | (1R,2S)-1,2-diphenylpropan-1-amine;methyl carbonochloridate;methyl N-[(1R,2S)-1,2-diphenylpropyl]carbamate |
|---|---|
| PubChem CID | 161215544 |
| Molecular Formula | C34H39ClN2O4 |
| Molecular Weight | 575.15 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | (1R,2S)-1,2-diphenylpropan-1-amine;methyl carbonochloridate;methyl N-[(1R,2S)-1,2-diphenylpropyl]carbamate |
| SMILES | COC(=O)Cl.COC(=O)N[C@@H](c1ccccc1)[C@@H](C)c1ccccc1.C[C@@H](c1ccccc1)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2.C15H17N.C2H3ClO2/c1-13(14-9-5-3-6-10-14)16(18-17(19)20-2)15-11-7-4-8-12-15;1-12(13-8-4-2-5-9-13)15(16)14-10-6-3-7-11-14;1-5-2(3)4/h3-13,16H,1-2H3,(H,18,19);2-12,15H,16H2,1H3;1H3/t13-,16+;12-,15+;/m00./s1 |
| InChIKey | UWUQXHLUZDXLCS-WPWILYRFSA-N |
| XLogP | 8.37 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.15 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|