C21H19FN4O2S — CID 161216984
2-[4-(1,3-benzoxazol-2-yl)butyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 161216984) has the molecular formula C21H19FN4O2S and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)butyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)butyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 161216984 |
| Molecular Formula | C21H19FN4O2S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)butyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ncccc1F)c1csc(CCCCc2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C21H19FN4O2S/c22-14-6-5-11-23-16(14)12-24-21(27)17-13-29-20(26-17)10-4-3-9-19-25-15-7-1-2-8-18(15)28-19/h1-2,5-8,11,13H,3-4,9-10,12H2,(H,24,27) |
| InChIKey | UWZOOLHOTABFTQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|