C13H28N4O — CID 161221277
1,4-dimethylpiperazine;1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 161221277) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 1,4-dimethylpiperazine;1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 161221277 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | 1,4-dimethylpiperazine;1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CC(=O)N1CCN(C)CC1.CN1CCN(C)CC1 |
| InChI | InChI=1S/C7H14N2O.C6H14N2/c1-7(10)9-5-3-8(2)4-6-9;1-7-3-5-8(2)6-4-7/h3-6H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | UXNUDEHMHDIJKZ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |