C18H19ClFN7 — CID 161224805
6-(6-chloro-2-pyridinyl)-4-N-(2,2-dimethylpropyl)-2-N-(2-fluoro-4-pyridinyl)-1,3,5-triazine-2,4-diamine (PubChem CID 161224805) has the molecular formula C18H19ClFN7 and a molecular weight of 387.85 g/mol. Its IUPAC name is 6-(6-chloro-2-pyridinyl)-4-N-(2,2-dimethylpropyl)-2-N-(2-fluoro-4-pyridinyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6-chloro-2-pyridinyl)-4-N-(2,2-dimethylpropyl)-2-N-(2-fluoro-4-pyridinyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 161224805 |
| Molecular Formula | C18H19ClFN7 |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 6-(6-chloro-2-pyridinyl)-4-N-(2,2-dimethylpropyl)-2-N-(2-fluoro-4-pyridinyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)CNc1nc(Nc2ccnc(F)c2)nc(-c2cccc(Cl)n2)n1 |
| InChI | InChI=1S/C18H19ClFN7/c1-18(2,3)10-22-16-25-15(12-5-4-6-13(19)24-12)26-17(27-16)23-11-7-8-21-14(20)9-11/h4-9H,10H2,1-3H3,(H2,21,22,23,25,26,27) |
| InChIKey | LVQDOYYLCILHIO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|