C13H8ClF3N2O5S — CID 161227512
2-(4-chlorophenyl)sulfonyl-3-nitropyridine;2,2,2-trifluoroacetaldehyde (PubChem CID 161227512) has the molecular formula C13H8ClF3N2O5S and a molecular weight of 396.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-3-nitropyridine;2,2,2-trifluoroacetaldehyde.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-3-nitropyridine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 161227512 |
| Molecular Formula | C13H8ClF3N2O5S |
| Molecular Weight | 396.73 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-3-nitropyridine;2,2,2-trifluoroacetaldehyde |
| SMILES | O=CC(F)(F)F.O=[N+]([O-])c1cccnc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H7ClN2O4S.C2HF3O/c12-8-3-5-9(6-4-8)19(17,18)11-10(14(15)16)2-1-7-13-11;3-2(4,5)1-6/h1-7H;1H |
| InChIKey | UYHYSUJNXXXNDX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 107.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.73 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|