C35H54N2O4 — CID 161228896
(3S)-1-benzyl-3-methyl-3-[2-(oxan-2-yloxy)ethoxymethyl]piperidine;[(3S)-1-benzyl-3-methylpiperidin-3-yl]methanol (PubChem CID 161228896) has the molecular formula C35H54N2O4 and a molecular weight of 566.83 g/mol. Its IUPAC name is (3S)-1-benzyl-3-methyl-3-[2-(oxan-2-yloxy)ethoxymethyl]piperidine;[(3S)-1-benzyl-3-methylpiperidin-3-yl]methanol.
| Compound Name | (3S)-1-benzyl-3-methyl-3-[2-(oxan-2-yloxy)ethoxymethyl]piperidine;[(3S)-1-benzyl-3-methylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 161228896 |
| Molecular Formula | C35H54N2O4 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.41 |
| IUPAC Name | (3S)-1-benzyl-3-methyl-3-[2-(oxan-2-yloxy)ethoxymethyl]piperidine;[(3S)-1-benzyl-3-methylpiperidin-3-yl]methanol |
| SMILES | C[C@]1(CO)CCCN(Cc2ccccc2)C1.C[C@]1(COCCOC2CCCCO2)CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H33NO3.C14H21NO/c1-21(18-23-14-15-25-20-10-5-6-13-24-20)11-7-12-22(17-21)16-19-8-3-2-4-9-19;1-14(12-16)8-5-9-15(11-14)10-13-6-3-2-4-7-13/h2-4,8-9,20H,5-7,10-18H2,1H3;2-4,6-7,16H,5,8-12H2,1H3/t20?,21-;14-/m00/s1 |
| InChIKey | UYMIPOVLFJSOCS-XABVCAHESA-N |
| XLogP | 6.13 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|