About methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate
methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate (PubChem CID 161230734) has the molecular formula C22H19IN2O6
and a molecular weight of 534.31 g/mol. Its IUPAC name is methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate.
Molecular Properties
| Compound Name | methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate |
| PubChem CID | 161230734 |
| Molecular Formula | C22H19IN2O6 |
| Molecular Weight | 534.31 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate |
| SMILES | COC(=O)c1cc(C#N)c(OC)c(C2CC2)c1.COC(=O)c1cc(I)c(O)c(C#N)c1 |
| InChI | InChI=1S/C13H13NO3.C9H6INO3/c1-16-12-10(7-14)5-9(13(15)17-2)6-11(12)8-3-4-8;1-14-9(13)5-2-6(4-11)8(12)7(10)3-5/h5-6,8H,3-4H2,1-2H3;2-3,12H,1H3 |
| InChIKey | UYSIDHOWNBNFAL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate?
The IUPAC name of methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate (CID 161230734) is methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate.
What is the SMILES notation for methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate?
The canonical SMILES for methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate is COC(=O)c1cc(C#N)c(OC)c(C2CC2)c1.COC(=O)c1cc(I)c(O)c(C#N)c1.
What is the InChIKey of methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate?
The InChIKey is UYSIDHOWNBNFAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3.C9H6INO3/c1-16-12-10(7-14)5-9(13(15)17-2)6-11(12)8-3-4-8;1-14-9(13)5-2-6(4-11)8(12)7(10)3-5/h5-6,8H,3-4H2,1-2H3;2-3,12H,1H3.
What are the key properties of methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate?
methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate has a molecular weight of 534.31 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-cyano-5-cyclopropyl-4-methoxybenzoate;methyl 3-cyano-4-hydroxy-5-iodobenzoate is sourced from PubChem (CID 161230734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).