About zinc;nonanoate;prop-2-enoate
zinc;nonanoate;prop-2-enoate (PubChem CID 161232725) has the molecular formula C12H20O4Zn
and a molecular weight of 293.68 g/mol. Its IUPAC name is zinc;nonanoate;prop-2-enoate.
Molecular Properties
| Compound Name | zinc;nonanoate;prop-2-enoate |
| PubChem CID | 161232725 |
| Molecular Formula | C12H20O4Zn |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | zinc;nonanoate;prop-2-enoate |
| SMILES | C=CC(=O)[O-].CCCCCCCCC(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C9H18O2.C3H4O2.Zn/c1-2-3-4-5-6-7-8-9(10)11;1-2-3(4)5;/h2-8H2,1H3,(H,10,11);2H,1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | UYYVWHXUZCYECC-UHFFFAOYSA-L |
| XLogP | 0.41 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;nonanoate;prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;nonanoate;prop-2-enoate?
The IUPAC name of zinc;nonanoate;prop-2-enoate (CID 161232725) is zinc;nonanoate;prop-2-enoate.
What is the SMILES notation for zinc;nonanoate;prop-2-enoate?
The canonical SMILES for zinc;nonanoate;prop-2-enoate is C=CC(=O)[O-].CCCCCCCCC(=O)[O-].[Zn+2].
What is the InChIKey of zinc;nonanoate;prop-2-enoate?
The InChIKey is UYYVWHXUZCYECC-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H18O2.C3H4O2.Zn/c1-2-3-4-5-6-7-8-9(10)11;1-2-3(4)5;/h2-8H2,1H3,(H,10,11);2H,1H2,(H,4,5);/q;;+2/p-2.
What are the key properties of zinc;nonanoate;prop-2-enoate?
zinc;nonanoate;prop-2-enoate has a molecular weight of 293.68 g/mol, XLogP of 0.41, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;nonanoate;prop-2-enoate is sourced from PubChem (CID 161232725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).