C11H10Cl2N4O5 — CID 161233819
1,2-dichloroethane;methyl 2-carbonazidoyl-3-nitrobenzoate (PubChem CID 161233819) has the molecular formula C11H10Cl2N4O5 and a molecular weight of 349.13 g/mol. Its IUPAC name is 1,2-dichloroethane;methyl 2-carbonazidoyl-3-nitrobenzoate.
| Compound Name | 1,2-dichloroethane;methyl 2-carbonazidoyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 161233819 |
| Molecular Formula | C11H10Cl2N4O5 |
| Molecular Weight | 349.13 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1,2-dichloroethane;methyl 2-carbonazidoyl-3-nitrobenzoate |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1C(=O)N=[N+]=[N-].ClCCCl |
| InChI | InChI=1S/C9H6N4O5.C2H4Cl2/c1-18-9(15)5-3-2-4-6(13(16)17)7(5)8(14)11-12-10;3-1-2-4/h2-4H,1H3;1-2H2 |
| InChIKey | UZCJGXMBPVBOAB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 135.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.13 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|