About [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate
[4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate (PubChem CID 161233953) has the molecular formula C17H34O5
and a molecular weight of 318.45 g/mol. Its IUPAC name is [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate.
Molecular Properties
| Compound Name | [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate |
| PubChem CID | 161233953 |
| Molecular Formula | C17H34O5 |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate |
| SMILES | CCCCOCCCCCC(=O)OCC(CCOC)COC |
| InChI | InChI=1S/C17H34O5/c1-4-5-11-21-12-8-6-7-9-17(18)22-15-16(14-20-3)10-13-19-2/h16H,4-15H2,1-3H3 |
| InChIKey | UZCUVAHLDQZRHW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate?
The IUPAC name of [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate (CID 161233953) is [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate.
What is the SMILES notation for [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate?
The canonical SMILES for [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate is CCCCOCCCCCC(=O)OCC(CCOC)COC.
What is the InChIKey of [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate?
The InChIKey is UZCUVAHLDQZRHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O5/c1-4-5-11-21-12-8-6-7-9-17(18)22-15-16(14-20-3)10-13-19-2/h16H,4-15H2,1-3H3.
What are the key properties of [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate?
[4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate has a molecular weight of 318.45 g/mol, XLogP of 3.21, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-2-(methoxymethyl)butyl] 6-butoxyhexanoate is sourced from PubChem (CID 161233953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).