About chlorobenzene;methyl hydrogen sulfate;pyridazine
chlorobenzene;methyl hydrogen sulfate;pyridazine (PubChem CID 161234770) has the molecular formula C11H13ClN2O4S
and a molecular weight of 304.76 g/mol. Its IUPAC name is chlorobenzene;methyl hydrogen sulfate;pyridazine.
Molecular Properties
| Compound Name | chlorobenzene;methyl hydrogen sulfate;pyridazine |
| PubChem CID | 161234770 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | chlorobenzene;methyl hydrogen sulfate;pyridazine |
| SMILES | COS(=O)(=O)O.Clc1ccccc1.c1ccnnc1 |
| InChI | InChI=1S/C6H5Cl.C4H4N2.CH4O4S/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;1-5-6(2,3)4/h1-5H;1-4H;1H3,(H,2,3,4) |
| InChIKey | UZFNPSUREVOGHV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze chlorobenzene;methyl hydrogen sulfate;pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;methyl hydrogen sulfate;pyridazine?
The IUPAC name of chlorobenzene;methyl hydrogen sulfate;pyridazine (CID 161234770) is chlorobenzene;methyl hydrogen sulfate;pyridazine.
What is the SMILES notation for chlorobenzene;methyl hydrogen sulfate;pyridazine?
The canonical SMILES for chlorobenzene;methyl hydrogen sulfate;pyridazine is COS(=O)(=O)O.Clc1ccccc1.c1ccnnc1.
What is the InChIKey of chlorobenzene;methyl hydrogen sulfate;pyridazine?
The InChIKey is UZFNPSUREVOGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl.C4H4N2.CH4O4S/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;1-5-6(2,3)4/h1-5H;1-4H;1H3,(H,2,3,4).
What are the key properties of chlorobenzene;methyl hydrogen sulfate;pyridazine?
chlorobenzene;methyl hydrogen sulfate;pyridazine has a molecular weight of 304.76 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;methyl hydrogen sulfate;pyridazine is sourced from PubChem (CID 161234770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).