C28H24F3N7O5 — CID 161249303
4-(3,4-difluorophenyl)-2-ethyl-6-[2-[3-fluoro-4-[[3-[[(2S)-1-hydroxypropan-2-yl]amino]-1H-pyrazolo[3,4-b]pyridin-4-yl]oxy]phenyl]acetyl]-1,2,4-triazine-3,5-dione (PubChem CID 161249303) has the molecular formula C28H24F3N7O5 and a molecular weight of 595.54 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-ethyl-6-[2-[3-fluoro-4-[[3-[[(2S)-1-hydroxypropan-2-yl]amino]-1H-pyrazolo[3,4-b]pyridin-4-yl]oxy]phenyl]acetyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 4-(3,4-difluorophenyl)-2-ethyl-6-[2-[3-fluoro-4-[[3-[[(2S)-1-hydroxypropan-2-yl]amino]-1H-pyrazolo[3,4-b]pyridin-4-yl]oxy]phenyl]acetyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 161249303 |
| Molecular Formula | C28H24F3N7O5 |
| Molecular Weight | 595.54 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-ethyl-6-[2-[3-fluoro-4-[[3-[[(2S)-1-hydroxypropan-2-yl]amino]-1H-pyrazolo[3,4-b]pyridin-4-yl]oxy]phenyl]acetyl]-1,2,4-triazine-3,5-dione |
| SMILES | CCn1nc(C(=O)Cc2ccc(Oc3ccnc4[nH]nc(N[C@@H](C)CO)c34)c(F)c2)c(=O)n(-c2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C28H24F3N7O5/c1-3-37-28(42)38(16-5-6-17(29)18(30)12-16)27(41)24(36-37)20(40)11-15-4-7-21(19(31)10-15)43-22-8-9-32-25-23(22)26(35-34-25)33-14(2)13-39/h4-10,12,14,39H,3,11,13H2,1-2H3,(H2,32,33,34,35)/t14-/m0/s1 |
| InChIKey | VBBCLQDICGNSER-AWEZNQCLSA-N |
| XLogP | 3.11 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |