C32H27NO6 — CID 161255200
4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile (PubChem CID 161255200) has the molecular formula C32H27NO6 and a molecular weight of 521.57 g/mol. Its IUPAC name is 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile.
| Compound Name | 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile |
|---|---|
| PubChem CID | 161255200 |
| Molecular Formula | C32H27NO6 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile |
| SMILES | N#Cc1ccc(CCOc2ccc(C=O)cc2)cc1.O=Cc1ccc(OCCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H13NO2.C16H14O4/c17-11-14-3-1-13(2-4-14)9-10-19-16-7-5-15(12-18)6-8-16;17-11-13-3-7-15(8-4-13)20-10-9-12-1-5-14(6-2-12)16(18)19/h1-8,12H,9-10H2;1-8,11H,9-10H2,(H,18,19) |
| InChIKey | VBUXNSNESVCMHR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|