About 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile
4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile (PubChem CID 161255200) has the molecular formula C32H27NO6
and a molecular weight of 521.57 g/mol. Its IUPAC name is 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile |
| PubChem CID | 161255200 |
| Molecular Formula | C32H27NO6 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile |
| SMILES | N#Cc1ccc(CCOc2ccc(C=O)cc2)cc1.O=Cc1ccc(OCCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H13NO2.C16H14O4/c17-11-14-3-1-13(2-4-14)9-10-19-16-7-5-15(12-18)6-8-16;17-11-13-3-7-15(8-4-13)20-10-9-12-1-5-14(6-2-12)16(18)19/h1-8,12H,9-10H2;1-8,11H,9-10H2,(H,18,19) |
| InChIKey | VBUXNSNESVCMHR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile?
The IUPAC name of 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile (CID 161255200) is 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile.
What is the SMILES notation for 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile?
The canonical SMILES for 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile is N#Cc1ccc(CCOc2ccc(C=O)cc2)cc1.O=Cc1ccc(OCCc2ccc(C(=O)O)cc2)cc1.
What is the InChIKey of 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile?
The InChIKey is VBUXNSNESVCMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2.C16H14O4/c17-11-14-3-1-13(2-4-14)9-10-19-16-7-5-15(12-18)6-8-16;17-11-13-3-7-15(8-4-13)20-10-9-12-1-5-14(6-2-12)16(18)19/h1-8,12H,9-10H2;1-8,11H,9-10H2,(H,18,19).
What are the key properties of 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile?
4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile has a molecular weight of 521.57 g/mol, XLogP of 5.81, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-formylphenoxy)ethyl]benzoic acid;4-[2-(4-formylphenoxy)ethyl]benzonitrile is sourced from PubChem (CID 161255200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).