C17H26O11 — CID 161259131
dimethyl 3-oxopentanedioate;methanol;methyl 2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetate (PubChem CID 161259131) has the molecular formula C17H26O11 and a molecular weight of 406.38 g/mol. Its IUPAC name is dimethyl 3-oxopentanedioate;methanol;methyl 2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetate.
| Compound Name | dimethyl 3-oxopentanedioate;methanol;methyl 2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetate |
|---|---|
| PubChem CID | 161259131 |
| Molecular Formula | C17H26O11 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | dimethyl 3-oxopentanedioate;methanol;methyl 2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetate |
| SMILES | CO.COC(=O)CC(=O)CC(=O)OC.COC(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C9H12O5.C7H10O5.CH4O/c1-9(2)13-6(4-7(10)12-3)5-8(11)14-9;1-11-6(9)3-5(8)4-7(10)12-2;1-2/h5H,4H2,1-3H3;3-4H2,1-2H3;2H,1H3 |
| InChIKey | VCIAKONGLSUKQG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|