C20H30N2S — CID 161260709
N-[(5-pyridin-2-ylthiophen-2-yl)methyl]decan-1-amine (PubChem CID 161260709) has the molecular formula C20H30N2S and a molecular weight of 330.54 g/mol. Its IUPAC name is N-[(5-pyridin-2-ylthiophen-2-yl)methyl]decan-1-amine.
| Compound Name | N-[(5-pyridin-2-ylthiophen-2-yl)methyl]decan-1-amine |
|---|---|
| PubChem CID | 161260709 |
| Molecular Formula | C20H30N2S |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-[(5-pyridin-2-ylthiophen-2-yl)methyl]decan-1-amine |
| SMILES | CCCCCCCCCCNCc1ccc(-c2ccccn2)s1 |
| InChI | InChI=1S/C20H30N2S/c1-2-3-4-5-6-7-8-10-15-21-17-18-13-14-20(23-18)19-12-9-11-16-22-19/h9,11-14,16,21H,2-8,10,15,17H2,1H3 |
| InChIKey | ZAAFLDXQKWJSPZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|