C22H12Cl4N12O4 — CID 161261960
2,6-dichloro-9-(5-nitro-2-pyridinyl)purine;N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide (PubChem CID 161261960) has the molecular formula C22H12Cl4N12O4 and a molecular weight of 650.23 g/mol. Its IUPAC name is 2,6-dichloro-9-(5-nitro-2-pyridinyl)purine;N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide.
| Compound Name | 2,6-dichloro-9-(5-nitro-2-pyridinyl)purine;N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 161261960 |
| Molecular Formula | C22H12Cl4N12O4 |
| Molecular Weight | 650.23 g/mol |
| Exact Mass | 647.99 |
| IUPAC Name | 2,6-dichloro-9-(5-nitro-2-pyridinyl)purine;N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)c1ccc(-n2cnc3c(Cl)nc(Cl)nc32)nc1.O=[N+]([O-])c1ccc(-n2cnc3c(Cl)nc(Cl)nc32)nc1 |
| InChI | InChI=1S/C12H8Cl2N6O2.C10H4Cl2N6O2/c1-6(21)20(22)7-2-3-8(15-4-7)19-5-16-9-10(13)17-12(14)18-11(9)19;11-8-7-9(16-10(12)15-8)17(4-14-7)6-2-1-5(3-13-6)18(19)20/h2-5,22H,1H3;1-4H |
| InChIKey | VCRADXVOGLZEIE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 196.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.23 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|