C26H37Cl2NO7 — CID 161262583
acetyl chloride;3-[(1S,2R)-6,7-dimethoxy-2-methyl-1-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propan-1-ol;chloride (PubChem CID 161262583) has the molecular formula C26H37Cl2NO7 and a molecular weight of 546.49 g/mol. Its IUPAC name is acetyl chloride;3-[(1S,2R)-6,7-dimethoxy-2-methyl-1-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propan-1-ol;chloride.
| Compound Name | acetyl chloride;3-[(1S,2R)-6,7-dimethoxy-2-methyl-1-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propan-1-ol;chloride |
|---|---|
| PubChem CID | 161262583 |
| Molecular Formula | C26H37Cl2NO7 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | acetyl chloride;3-[(1S,2R)-6,7-dimethoxy-2-methyl-1-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propan-1-ol;chloride |
| SMILES | CC(=O)Cl.COc1cc2c(cc1OC)[C@H](c1cc(OC)c(OC)c(OC)c1)[N@@+](C)(CCCO)CC2.[Cl-] |
| InChI | InChI=1S/C24H34NO6.C2H3ClO.ClH/c1-25(9-7-11-26)10-8-16-12-19(27-2)20(28-3)15-18(16)23(25)17-13-21(29-4)24(31-6)22(14-17)30-5;1-2(3)4;/h12-15,23,26H,7-11H2,1-6H3;1H3;1H/q+1;;/p-1/t23-,25-;;/m0../s1 |
| InChIKey | RANDODIHOPFPAG-WYBXAQPNSA-M |
| XLogP | 0.98 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|