C32H47Cl2NO9 — CID 173282105
2-[3-[(1S,2R)-6,7-dimethoxy-2-methyl-1-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]-8-hydroxy-8-oxooctanoate;dihydrochloride (PubChem CID 173282105) has the molecular formula C32H47Cl2NO9 and a molecular weight of 660.63 g/mol. Its IUPAC name is 2-[3-[(1S,2R)-6,7-dimethoxy-2-methyl-1-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]-8-hydroxy-8-oxooctanoate;dihydrochloride.
| Compound Name | 2-[3-[(1S,2R)-6,7-dimethoxy-2-methyl-1-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]-8-hydroxy-8-oxooctanoate;dihydrochloride |
|---|---|
| PubChem CID | 173282105 |
| Molecular Formula | C32H47Cl2NO9 |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | 2-[3-[(1S,2R)-6,7-dimethoxy-2-methyl-1-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]-8-hydroxy-8-oxooctanoate;dihydrochloride |
| SMILES | COc1cc2c(cc1OC)[C@H](c1cc(OC)c(OC)c(OC)c1)[N@+](C)(CCCC(CCCCCC(=O)O)C(=O)[O-])CC2.Cl.Cl |
| InChI | InChI=1S/C32H45NO9.2ClH/c1-33(15-10-12-21(32(36)37)11-8-7-9-13-29(34)35)16-14-22-17-25(38-2)26(39-3)20-24(22)30(33)23-18-27(40-4)31(42-6)28(19-23)41-5;;/h17-21,30H,7-16H2,1-6H3,(H-,34,35,36,37);2*1H/t21?,30-,33+;;/m0../s1 |
| InChIKey | CLQCODKDXRXWBI-KYMMJQHOSA-N |
| XLogP | 4.85 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|