C31H45Cl2NO9 — CID 173282140
2-[3-[(1R,2S)-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]-6-hydroxy-6-oxohexanoate;dihydrochloride (PubChem CID 173282140) has the molecular formula C31H45Cl2NO9 and a molecular weight of 646.61 g/mol. Its IUPAC name is 2-[3-[(1R,2S)-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]-6-hydroxy-6-oxohexanoate;dihydrochloride.
| Compound Name | 2-[3-[(1R,2S)-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]-6-hydroxy-6-oxohexanoate;dihydrochloride |
|---|---|
| PubChem CID | 173282140 |
| Molecular Formula | C31H45Cl2NO9 |
| Molecular Weight | 646.61 g/mol |
| Exact Mass | 645.25 |
| IUPAC Name | 2-[3-[(1R,2S)-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]-6-hydroxy-6-oxohexanoate;dihydrochloride |
| SMILES | COc1cc2c(cc1OC)[C@@H](Cc1cc(OC)c(OC)c(OC)c1)[N@@+](C)(CCCC(CCCC(=O)O)C(=O)[O-])CC2.Cl.Cl |
| InChI | InChI=1S/C31H43NO9.2ClH/c1-32(13-8-10-21(31(35)36)9-7-11-29(33)34)14-12-22-18-25(37-2)26(38-3)19-23(22)24(32)15-20-16-27(39-4)30(41-6)28(17-20)40-5;;/h16-19,21,24H,7-15H2,1-6H3,(H-,33,34,35,36);2*1H/t21?,24-,32+;;/m1../s1 |
| InChIKey | NRTZMINVNJRXMD-HTVVRCQZSA-N |
| XLogP | 4.26 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|