C24H29NO3 — CID 161263252
(6R)-4-ethyl-3-[2-oxo-3-(4-propan-2-ylphenyl)propyl]-6-phenylmorpholin-2-one (PubChem CID 161263252) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is (6R)-4-ethyl-3-[2-oxo-3-(4-propan-2-ylphenyl)propyl]-6-phenylmorpholin-2-one.
| Compound Name | (6R)-4-ethyl-3-[2-oxo-3-(4-propan-2-ylphenyl)propyl]-6-phenylmorpholin-2-one |
|---|---|
| PubChem CID | 161263252 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (6R)-4-ethyl-3-[2-oxo-3-(4-propan-2-ylphenyl)propyl]-6-phenylmorpholin-2-one |
| SMILES | CCN1C[C@@H](c2ccccc2)OC(=O)C1CC(=O)Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C24H29NO3/c1-4-25-16-23(20-8-6-5-7-9-20)28-24(27)22(25)15-21(26)14-18-10-12-19(13-11-18)17(2)3/h5-13,17,22-23H,4,14-16H2,1-3H3/t22?,23-/m0/s1 |
| InChIKey | VCVMVUKRKPAUTL-WCSIJFPASA-N |
| XLogP | 4.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |