C44H46N8O3Si — CID 161263640
1-[(3-aminophenyl)methyl]-5-(1H-indazol-6-yl)pyridin-2-one;1-[(3-aminophenyl)methyl]-5-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]pyridin-2-one (PubChem CID 161263640) has the molecular formula C44H46N8O3Si and a molecular weight of 762.99 g/mol. Its IUPAC name is 1-[(3-aminophenyl)methyl]-5-(1H-indazol-6-yl)pyridin-2-one;1-[(3-aminophenyl)methyl]-5-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]pyridin-2-one.
| Compound Name | 1-[(3-aminophenyl)methyl]-5-(1H-indazol-6-yl)pyridin-2-one;1-[(3-aminophenyl)methyl]-5-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]pyridin-2-one |
|---|---|
| PubChem CID | 161263640 |
| Molecular Formula | C44H46N8O3Si |
| Molecular Weight | 762.99 g/mol |
| Exact Mass | 762.35 |
| IUPAC Name | 1-[(3-aminophenyl)methyl]-5-(1H-indazol-6-yl)pyridin-2-one;1-[(3-aminophenyl)methyl]-5-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]pyridin-2-one |
| SMILES | C[Si](C)(C)CCOCn1ncc2ccc(-c3ccc(=O)n(Cc4cccc(N)c4)c3)cc21.Nc1cccc(Cn2cc(-c3ccc4cn[nH]c4c3)ccc2=O)c1 |
| InChI | InChI=1S/C25H30N4O2Si.C19H16N4O/c1-32(2,3)12-11-31-18-29-24-14-20(7-8-21(24)15-27-29)22-9-10-25(30)28(17-22)16-19-5-4-6-23(26)13-19;20-17-3-1-2-13(8-17)11-23-12-16(6-7-19(23)24)14-4-5-15-10-21-22-18(15)9-14/h4-10,13-15,17H,11-12,16,18,26H2,1-3H3;1-10,12H,11,20H2,(H,21,22) |
| InChIKey | VCWSPGGQQZVEBM-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 151.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.99 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|