C23H44N2O8S — CID 161264559
tert-butyl 4-hydroxypiperidine-1-carboxylate;tert-butyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethene (PubChem CID 161264559) has the molecular formula C23H44N2O8S and a molecular weight of 508.68 g/mol. Its IUPAC name is tert-butyl 4-hydroxypiperidine-1-carboxylate;tert-butyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethene.
| Compound Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;tert-butyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethene |
|---|---|
| PubChem CID | 161264559 |
| Molecular Formula | C23H44N2O8S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;tert-butyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethene |
| SMILES | C=C.CC(C)(C)OC(=O)N1CCC(O)CC1.CC(C)(C)OC(=O)N1CCC(OS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H21NO5S.C10H19NO3.C2H4/c1-11(2,3)16-10(13)12-7-5-9(6-8-12)17-18(4,14)15;1-10(2,3)14-9(13)11-6-4-8(12)5-7-11;1-2/h9H,5-8H2,1-4H3;8,12H,4-7H2,1-3H3;1-2H2 |
| InChIKey | VCZRFBLVUAZLRT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|