C32H32BCl3N6O2 — CID 161266839
4-chloro-2-(1-methylpyrazol-4-yl)quinoline;2,4-dichloroquinoline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 161266839) has the molecular formula C32H32BCl3N6O2 and a molecular weight of 649.82 g/mol. Its IUPAC name is 4-chloro-2-(1-methylpyrazol-4-yl)quinoline;2,4-dichloroquinoline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 4-chloro-2-(1-methylpyrazol-4-yl)quinoline;2,4-dichloroquinoline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 161266839 |
| Molecular Formula | C32H32BCl3N6O2 |
| Molecular Weight | 649.82 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | 4-chloro-2-(1-methylpyrazol-4-yl)quinoline;2,4-dichloroquinoline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Clc1cc(Cl)c2ccccc2n1.Cn1cc(-c2cc(Cl)c3ccccc3n2)cn1.Cn1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C13H10ClN3.C10H17BN2O2.C9H5Cl2N/c1-17-8-9(7-15-17)13-6-11(14)10-4-2-3-5-12(10)16-13;1-9(2)10(3,4)15-11(14-9)8-6-12-13(5)7-8;10-7-5-9(11)12-8-4-2-1-3-6(7)8/h2-8H,1H3;6-7H,1-5H3;1-5H |
| InChIKey | VDHKPNCJUISEJI-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.82 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|