C30H25F5N6O4S — CID 161267581
1-[3-(4-fluoro-5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenoxy]methyl]urea (PubChem CID 161267581) has the molecular formula C30H25F5N6O4S and a molecular weight of 660.63 g/mol. Its IUPAC name is 1-[3-(4-fluoro-5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenoxy]methyl]urea.
| Compound Name | 1-[3-(4-fluoro-5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenoxy]methyl]urea |
|---|---|
| PubChem CID | 161267581 |
| Molecular Formula | C30H25F5N6O4S |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | 1-[3-(4-fluoro-5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenoxy]methyl]urea |
| SMILES | Cc1cc(N2C(=O)CSC2=NC(=O)NCOc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2F)c(C(C)C)cc1F |
| InChI | InChI=1S/C30H25F5N6O4S/c1-16(2)21-12-22(31)17(3)10-24(21)41-26(42)13-46-29(41)38-28(43)37-15-44-25-9-4-18(11-23(25)32)27-36-14-40(39-27)19-5-7-20(8-6-19)45-30(33,34)35/h4-12,14,16H,13,15H2,1-3H3,(H,37,43) |
| InChIKey | VDJVYIPUHUIELR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|