C31H28N4O6S2 — CID 161269018
1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine;1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde;oxolane (PubChem CID 161269018) has the molecular formula C31H28N4O6S2 and a molecular weight of 616.72 g/mol. Its IUPAC name is 1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine;1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde;oxolane.
| Compound Name | 1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine;1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde;oxolane |
|---|---|
| PubChem CID | 161269018 |
| Molecular Formula | C31H28N4O6S2 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | 1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine;1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde;oxolane |
| SMILES | C1CCOC1.O=Cc1cc2cccnc2n1S(=O)(=O)c1ccccc1.O=S(=O)(c1ccccc1)n1ccc2cccnc21 |
| InChI | InChI=1S/C14H10N2O3S.C13H10N2O2S.C4H8O/c17-10-12-9-11-5-4-8-15-14(11)16(12)20(18,19)13-6-2-1-3-7-13;16-18(17,12-6-2-1-3-7-12)15-10-8-11-5-4-9-14-13(11)15;1-2-4-5-3-1/h1-10H;1-10H;1-4H2 |
| InChIKey | VDOIDKVTLNKLAE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 130.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|