C24H31BBr2N2O5 — CID 161270290
cyano-(2-ethenyl-1-ethoxycarbonylcyclopropyl)borinic acid;(E)-1,4-dibromobut-2-ene;ethyl 2-(benzylideneamino)acetate (PubChem CID 161270290) has the molecular formula C24H31BBr2N2O5 and a molecular weight of 598.14 g/mol. Its IUPAC name is cyano-(2-ethenyl-1-ethoxycarbonylcyclopropyl)borinic acid;(E)-1,4-dibromobut-2-ene;ethyl 2-(benzylideneamino)acetate.
| Compound Name | cyano-(2-ethenyl-1-ethoxycarbonylcyclopropyl)borinic acid;(E)-1,4-dibromobut-2-ene;ethyl 2-(benzylideneamino)acetate |
|---|---|
| PubChem CID | 161270290 |
| Molecular Formula | C24H31BBr2N2O5 |
| Molecular Weight | 598.14 g/mol |
| Exact Mass | 596.07 |
| IUPAC Name | cyano-(2-ethenyl-1-ethoxycarbonylcyclopropyl)borinic acid;(E)-1,4-dibromobut-2-ene;ethyl 2-(benzylideneamino)acetate |
| SMILES | BrC/C=C/CBr.C=CC1CC1(B(O)C#N)C(=O)OCC.CCOC(=O)C/N=C/c1ccccc1 |
| InChI | InChI=1S/C11H13NO2.C9H12BNO3.C4H6Br2/c1-2-14-11(13)9-12-8-10-6-4-3-5-7-10;1-3-7-5-9(7,10(13)6-11)8(12)14-4-2;5-3-1-2-4-6/h3-8H,2,9H2,1H3;3,7,13H,1,4-5H2,2H3;1-2H,3-4H2/b12-8+;;2-1+ |
| InChIKey | VDSKLBFEOGFQMM-SBLLVXLRSA-N |
| XLogP | 4.54 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.14 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|