C12H26N2 — CID 161278602
N,1-di(propan-2-yl)pyrrolidin-2-imine;ethane (PubChem CID 161278602) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is N,1-di(propan-2-yl)pyrrolidin-2-imine;ethane.
| Compound Name | N,1-di(propan-2-yl)pyrrolidin-2-imine;ethane |
|---|---|
| PubChem CID | 161278602 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N,1-di(propan-2-yl)pyrrolidin-2-imine;ethane |
| SMILES | CC.CC(C)/N=C1\CCCN1C(C)C |
| InChI | InChI=1S/C10H20N2.C2H6/c1-8(2)11-10-6-5-7-12(10)9(3)4;1-2/h8-9H,5-7H2,1-4H3;1-2H3/b11-10+; |
| InChIKey | VETSSUIIULUYKK-ASTDGNLGSA-N |
| XLogP | 3.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|