C20H23ClN4O — CID 161284649
3-[5-[2-[1-(2-chloroethyl)pyrrolidin-2-yl]ethyl]pyrazolo[1,5-a]pyrimidin-3-yl]phenol (PubChem CID 161284649) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is 3-[5-[2-[1-(2-chloroethyl)pyrrolidin-2-yl]ethyl]pyrazolo[1,5-a]pyrimidin-3-yl]phenol.
| Compound Name | 3-[5-[2-[1-(2-chloroethyl)pyrrolidin-2-yl]ethyl]pyrazolo[1,5-a]pyrimidin-3-yl]phenol |
|---|---|
| PubChem CID | 161284649 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[5-[2-[1-(2-chloroethyl)pyrrolidin-2-yl]ethyl]pyrazolo[1,5-a]pyrimidin-3-yl]phenol |
| SMILES | Oc1cccc(-c2cnn3ccc(CCC4CCCN4CCCl)nc23)c1 |
| InChI | InChI=1S/C20H23ClN4O/c21-9-12-24-10-2-4-17(24)7-6-16-8-11-25-20(23-16)19(14-22-25)15-3-1-5-18(26)13-15/h1,3,5,8,11,13-14,17,26H,2,4,6-7,9-10,12H2 |
| InChIKey | VFNZQCJFJYWSOI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|