C11H14ArN2O2 — CID 161286279
argon;6,6-dimethyl-4-oxo-5,7-dihydro-1H-indole-3-carboxamide (PubChem CID 161286279) has the molecular formula C11H14ArN2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is argon;6,6-dimethyl-4-oxo-5,7-dihydro-1H-indole-3-carboxamide.
| Compound Name | argon;6,6-dimethyl-4-oxo-5,7-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 161286279 |
| Molecular Formula | C11H14ArN2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | argon;6,6-dimethyl-4-oxo-5,7-dihydro-1H-indole-3-carboxamide |
| SMILES | CC1(C)CC(=O)c2c(C(N)=O)c[nH]c2C1.[Ar] |
| InChI | InChI=1S/C11H14N2O2.Ar/c1-11(2)3-7-9(8(14)4-11)6(5-13-7)10(12)15;/h5,13H,3-4H2,1-2H3,(H2,12,15); |
| InChIKey | VFTMSDTYGBVOBM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |