C26H48N4O — CID 161291744
7-(2,3,3-trimethylbutan-2-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;(5R)-8-(2,3,3-trimethylbutan-2-yl)-3-oxa-8-azabicyclo[3.2.1]octane (PubChem CID 161291744) has the molecular formula C26H48N4O and a molecular weight of 432.70 g/mol. Its IUPAC name is 7-(2,3,3-trimethylbutan-2-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;(5R)-8-(2,3,3-trimethylbutan-2-yl)-3-oxa-8-azabicyclo[3.2.1]octane.
| Compound Name | 7-(2,3,3-trimethylbutan-2-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;(5R)-8-(2,3,3-trimethylbutan-2-yl)-3-oxa-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 161291744 |
| Molecular Formula | C26H48N4O |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.38 |
| IUPAC Name | 7-(2,3,3-trimethylbutan-2-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;(5R)-8-(2,3,3-trimethylbutan-2-yl)-3-oxa-8-azabicyclo[3.2.1]octane |
| SMILES | CC(C)(C)C(C)(C)N1C2CC[C@@H]1COC2.CC(C)(C)C(C)(C)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C13H23N3.C13H25NO/c1-12(2,3)13(4,5)16-9-8-15-7-6-14-11(15)10-16;1-12(2,3)13(4,5)14-10-6-7-11(14)9-15-8-10/h6-7H,8-10H2,1-5H3;10-11H,6-9H2,1-5H3/t;10-,11?/m.1/s1 |
| InChIKey | VGLBMXLBFBCENX-QWHABDPLSA-N |
| XLogP | 5.20 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |