C42H84N6 — CID 161301958
2,5-ditert-butyl-2,5-diazabicyclo[2.2.1]heptane;3,9-ditert-butyl-3,9-diazabicyclo[3.3.1]nonane;3,8-ditert-butyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 161301958) has the molecular formula C42H84N6 and a molecular weight of 673.18 g/mol. Its IUPAC name is 2,5-ditert-butyl-2,5-diazabicyclo[2.2.1]heptane;3,9-ditert-butyl-3,9-diazabicyclo[3.3.1]nonane;3,8-ditert-butyl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 2,5-ditert-butyl-2,5-diazabicyclo[2.2.1]heptane;3,9-ditert-butyl-3,9-diazabicyclo[3.3.1]nonane;3,8-ditert-butyl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 161301958 |
| Molecular Formula | C42H84N6 |
| Molecular Weight | 673.18 g/mol |
| Exact Mass | 672.68 |
| IUPAC Name | 2,5-ditert-butyl-2,5-diazabicyclo[2.2.1]heptane;3,9-ditert-butyl-3,9-diazabicyclo[3.3.1]nonane;3,8-ditert-butyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CC(C)(C)N1CC2CC1CN2C(C)(C)C.CC(C)(C)N1CC2CCC(C1)N2C(C)(C)C.CC(C)(C)N1CC2CCCC(C1)N2C(C)(C)C |
| InChI | InChI=1S/C15H30N2.C14H28N2.C13H26N2/c1-14(2,3)16-10-12-8-7-9-13(11-16)17(12)15(4,5)6;1-13(2,3)15-9-11-7-8-12(10-15)16(11)14(4,5)6;1-12(2,3)14-8-11-7-10(14)9-15(11)13(4,5)6/h12-13H,7-11H2,1-6H3;11-12H,7-10H2,1-6H3;10-11H,7-9H2,1-6H3 |
| InChIKey | VHSWHLJGANYEFI-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.18 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |