C9H7ClF3N3 — CID 161303532
2-chloro-N-methyl-5-(trifluoromethyl)-7H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 161303532) has the molecular formula C9H7ClF3N3 and a molecular weight of 249.62 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-(trifluoromethyl)-7H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-methyl-5-(trifluoromethyl)-7H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 161303532 |
| Molecular Formula | C9H7ClF3N3 |
| Molecular Weight | 249.62 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 2-chloro-N-methyl-5-(trifluoromethyl)-7H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CNc1nc(Cl)nc2c1C(C(F)(F)F)=CC2 |
| InChI | InChI=1S/C9H7ClF3N3/c1-14-7-6-4(9(11,12)13)2-3-5(6)15-8(10)16-7/h2H,3H2,1H3,(H,14,15,16) |
| InChIKey | SXXVPSTZKBEUGI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.62 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |