C12H14F3N5 — CID 146558065
4-N-methyl-6-[(2E,4Z)-1,1,1-trifluoro-2-(methylideneamino)hexa-2,4-dien-3-yl]pyrimidine-2,4-diamine (PubChem CID 146558065) has the molecular formula C12H14F3N5 and a molecular weight of 285.27 g/mol. Its IUPAC name is 4-N-methyl-6-[(2E,4Z)-1,1,1-trifluoro-2-(methylideneamino)hexa-2,4-dien-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-methyl-6-[(2E,4Z)-1,1,1-trifluoro-2-(methylideneamino)hexa-2,4-dien-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 146558065 |
| Molecular Formula | C12H14F3N5 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-N-methyl-6-[(2E,4Z)-1,1,1-trifluoro-2-(methylideneamino)hexa-2,4-dien-3-yl]pyrimidine-2,4-diamine |
| SMILES | C=N/C(=C(\C=C/C)c1cc(NC)nc(N)n1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3N5/c1-4-5-7(10(18-3)12(13,14)15)8-6-9(17-2)20-11(16)19-8/h4-6H,3H2,1-2H3,(H3,16,17,19,20)/b5-4-,10-7+ |
| InChIKey | NURGXJQHPVGKBD-DOIONKORSA-N |
| XLogP | 2.65 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|