C30H39ClN2O6 — CID 161309703
(E)-4-(dimethylamino)but-3-en-2-one;(3E)-3-(dimethylaminomethylidene)-1-phenylmethoxypentane-2,4-dione;2-phenylmethoxyacetyl chloride (PubChem CID 161309703) has the molecular formula C30H39ClN2O6 and a molecular weight of 559.10 g/mol. Its IUPAC name is (E)-4-(dimethylamino)but-3-en-2-one;(3E)-3-(dimethylaminomethylidene)-1-phenylmethoxypentane-2,4-dione;2-phenylmethoxyacetyl chloride.
| Compound Name | (E)-4-(dimethylamino)but-3-en-2-one;(3E)-3-(dimethylaminomethylidene)-1-phenylmethoxypentane-2,4-dione;2-phenylmethoxyacetyl chloride |
|---|---|
| PubChem CID | 161309703 |
| Molecular Formula | C30H39ClN2O6 |
| Molecular Weight | 559.10 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (E)-4-(dimethylamino)but-3-en-2-one;(3E)-3-(dimethylaminomethylidene)-1-phenylmethoxypentane-2,4-dione;2-phenylmethoxyacetyl chloride |
| SMILES | CC(=O)/C(=C\N(C)C)C(=O)COCc1ccccc1.CC(=O)/C=C/N(C)C.O=C(Cl)COCc1ccccc1 |
| InChI | InChI=1S/C15H19NO3.C9H9ClO2.C6H11NO/c1-12(17)14(9-16(2)3)15(18)11-19-10-13-7-5-4-6-8-13;10-9(11)7-12-6-8-4-2-1-3-5-8;1-6(8)4-5-7(2)3/h4-9H,10-11H2,1-3H3;1-5H,6-7H2;4-5H,1-3H3/b14-9+;;5-4+ |
| InChIKey | VISJLBDEFPZDQK-UJTIZTNHSA-N |
| XLogP | 4.43 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.10 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|