C38H47NO11 — CID 158273272
tert-butyl (2E)-2-(dimethylaminomethylidene)-3-oxo-4-phenylmethoxybutanoate;5-O-tert-butyl 2-O-ethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate (PubChem CID 158273272) has the molecular formula C38H47NO11 and a molecular weight of 693.79 g/mol. Its IUPAC name is tert-butyl (2E)-2-(dimethylaminomethylidene)-3-oxo-4-phenylmethoxybutanoate;5-O-tert-butyl 2-O-ethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate.
| Compound Name | tert-butyl (2E)-2-(dimethylaminomethylidene)-3-oxo-4-phenylmethoxybutanoate;5-O-tert-butyl 2-O-ethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate |
|---|---|
| PubChem CID | 158273272 |
| Molecular Formula | C38H47NO11 |
| Molecular Weight | 693.79 g/mol |
| Exact Mass | 693.31 |
| IUPAC Name | tert-butyl (2E)-2-(dimethylaminomethylidene)-3-oxo-4-phenylmethoxybutanoate;5-O-tert-butyl 2-O-ethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1occ(C(=O)OC(C)(C)C)c(=O)c1OCc1ccccc1.CN(C)/C=C(\C(=O)COCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H22O7.C18H25NO4/c1-5-24-19(23)17-16(25-11-13-9-7-6-8-10-13)15(21)14(12-26-17)18(22)27-20(2,3)4;1-18(2,3)23-17(21)15(11-19(4)5)16(20)13-22-12-14-9-7-6-8-10-14/h6-10,12H,5,11H2,1-4H3;6-11H,12-13H2,1-5H3/b;15-11+ |
| InChIKey | GJHOZPHZEVHQMN-AJKCDHROSA-N |
| XLogP | 5.91 |
| TPSA | 147.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.79 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|