C45H53F3IrNO2- — CID 161311956
3-hydroxy-3-(4-methylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-one;iridium;1-(2H-naphthalen-2-id-1-yl)-7-(4-propylcyclohexyl)isoquinoline (PubChem CID 161311956) has the molecular formula C45H53F3IrNO2- and a molecular weight of 889.13 g/mol. Its IUPAC name is 3-hydroxy-3-(4-methylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-one;iridium;1-(2H-naphthalen-2-id-1-yl)-7-(4-propylcyclohexyl)isoquinoline.
| Compound Name | 3-hydroxy-3-(4-methylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-one;iridium;1-(2H-naphthalen-2-id-1-yl)-7-(4-propylcyclohexyl)isoquinoline |
|---|---|
| PubChem CID | 161311956 |
| Molecular Formula | C45H53F3IrNO2- |
| Molecular Weight | 889.13 g/mol |
| Exact Mass | 889.37 |
| IUPAC Name | 3-hydroxy-3-(4-methylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-one;iridium;1-(2H-naphthalen-2-id-1-yl)-7-(4-propylcyclohexyl)isoquinoline |
| SMILES | CC1CCC(C(O)=CC(=O)C2CCC(C(F)(F)F)CC2)CC1.CCCC1CCC(c2ccc3ccnc(-c4[c-]ccc5ccccc45)c3c2)CC1.[Ir] |
| InChI | InChI=1S/C28H28N.C17H25F3O2.Ir/c1-2-6-20-11-13-21(14-12-20)24-16-15-23-17-18-29-28(27(23)19-24)26-10-5-8-22-7-3-4-9-25(22)26;1-11-2-4-12(5-3-11)15(21)10-16(22)13-6-8-14(9-7-13)17(18,19)20;/h3-5,7-9,15-21H,2,6,11-14H2,1H3;10-14,21H,2-9H2,1H3;/q-1;; |
| InChIKey | VBTAONARLFFIIR-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.13 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|