C24H26N4O5 — CID 161315190
N-(2-hydroxy-5-oxooxolan-3-yl)-6-(isoquinolin-1-ylamino)-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide (PubChem CID 161315190) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-(2-hydroxy-5-oxooxolan-3-yl)-6-(isoquinolin-1-ylamino)-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide.
| Compound Name | N-(2-hydroxy-5-oxooxolan-3-yl)-6-(isoquinolin-1-ylamino)-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
|---|---|
| PubChem CID | 161315190 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-(2-hydroxy-5-oxooxolan-3-yl)-6-(isoquinolin-1-ylamino)-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
| SMILES | O=C1CC(NC(=O)C2CCC3CC=CCC(Nc4nccc5ccccc45)C(=O)N32)C(O)O1 |
| InChI | InChI=1S/C24H26N4O5/c29-20-13-18(24(32)33-20)27-22(30)19-10-9-15-6-2-4-8-17(23(31)28(15)19)26-21-16-7-3-1-5-14(16)11-12-25-21/h1-5,7,11-12,15,17-19,24,32H,6,8-10,13H2,(H,25,26)(H,27,30) |
| InChIKey | VJKCMCPRIBXEHK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|