C24H29N3O6 — CID 58632010
(3S,6S,8Z,10aR)-6-benzamido-N-[(3S)-2-ethoxy-5-oxooxolan-3-yl]-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide (PubChem CID 58632010) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is (3S,6S,8Z,10aR)-6-benzamido-N-[(3S)-2-ethoxy-5-oxooxolan-3-yl]-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide.
| Compound Name | (3S,6S,8Z,10aR)-6-benzamido-N-[(3S)-2-ethoxy-5-oxooxolan-3-yl]-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
|---|---|
| PubChem CID | 58632010 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (3S,6S,8Z,10aR)-6-benzamido-N-[(3S)-2-ethoxy-5-oxooxolan-3-yl]-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
| SMILES | CCOC1OC(=O)C[C@@H]1NC(=O)[C@@H]1CC[C@@H]2C/C=C\C[C@H](NC(=O)c3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C24H29N3O6/c1-2-32-24-18(14-20(28)33-24)26-22(30)19-13-12-16-10-6-7-11-17(23(31)27(16)19)25-21(29)15-8-4-3-5-9-15/h3-9,16-19,24H,2,10-14H2,1H3,(H,25,29)(H,26,30)/b7-6-/t16-,17-,18-,19-,24?/m0/s1 |
| InChIKey | INGWTRIWYLEONP-SXILQVKWSA-N |
| XLogP | 1.29 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|